CAS 2109874-10-2 appears in our catalog under these names: (1S)-1-(4-Bromo-3-fluorophenyl)ethylamine hydrochloride, 95%, (S)–1–(4–Bromo–3–fluorophenyl)ethanamine hydrochloride, (S)-1-(4-Bromo-3-fluorophenyl)ethanamine hydrochloride, 98%, 98%, (S)-1-(4-Bromo-3-fluorophenyl)ethanamine hydrochloride, 98%, (S)-1-(4-Bromo-3-fluorophenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg.
(1S)-1-(4-bromo-3-fluorophenyl)ethanamine;hydrochloride (CAS 2109874-10-2) is a chemical compound with the molecular formula C8H10BrClFN and a molecular weight of 254.53 g/mol. IUPAC name: (1S)-1-(4-bromo-3-fluorophenyl)ethanamine;hydrochloride. InChIKey: BLXILKBUBMZCET-JEDNCBNOSA-N.
| Molecular formula | C8H10BrClFN |
|---|---|
| Molecular weight | 254.53 g/mol |
| IUPAC name | (1S)-1-(4-bromo-3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | BLXILKBUBMZCET-JEDNCBNOSA-N |
| SMILES | C[C@@H](C1=CC(=C(C=C1)Br)F)N.Cl |
Computed by PubChem (NCBI)