cas: 1169576-95-7 — see every product listed under this CAS number, including other names
(R)-1-(4-Fluorophenyl)propan-1-amine hydrochloride, 97%, 97% (CAS 1169576-95-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111DEO-250mg |
| cas | 1169576-95-7 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 1g | 779.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(1R)-1-(4-fluorophenyl)propan-1-amine;hydrochloride (CAS 1169576-95-7) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(4-fluorophenyl)propan-1-amine;hydrochloride. InChIKey: SNOAOHJQSMWUAH-SBSPUUFOSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(4-fluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | SNOAOHJQSMWUAH-SBSPUUFOSA-N |
| SMILES | CC[C@H](C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)