CAS 1213096-70-8 appears in our catalog under these names: (1R)-1-(4-Fluoro-3-methylphenyl)ethylamine hydrochloride, 95%, (R)-1-(4-Fluoro-3-methylphenyl)ethanamine hydrochloride, 98%, (1R)-1-(4-Fluoro-3-methylphenyl)ethan-1-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 50mg, 100mg, 500mg.
(1R)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride (CAS 1213096-70-8) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1R)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride. InChIKey: HZEFSEOLAJTAQO-OGFXRTJISA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1R)-1-(4-fluoro-3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | HZEFSEOLAJTAQO-OGFXRTJISA-N |
| SMILES | CC1=C(C=CC(=C1)[C@@H](C)N)F.Cl |
Computed by PubChem (NCBI)