CAS 2138165-91-8 appears in our catalog under these names: 1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 95%, 1–(3–Fluoro–4–methylphenyl)ethanamine hydrochloride, 1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 1-(3-Fluoro-4-methylphenyl)ethan-1-amine hydrochloride, 97%, 97%, 1-(3-Fluoro-4-methylphenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 0,5g, 50mg.
1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride (CAS 2138165-91-8) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: 1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride. InChIKey: JBLAOTNJWNXKOA-UHFFFAOYSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | 1-(3-fluoro-4-methylphenyl)ethanamine;hydrochloride |
| InChIKey | JBLAOTNJWNXKOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(C)N)F.Cl |
Computed by PubChem (NCBI)