CAS 1310923-28-4 appears in our catalog under these names: (S)-1-(2-Fluorophenyl)propan-1-amine hydrochloride, 95%, (S)-1-(2-Fluorophenyl)propan-1-amine hydrochloride, (S)-1-(2-Fluorophenyl)propan-1-amine hydrochloride 98%, (S)-1-(2-Fluorophenyl)propan-1-amine hydrochloride, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
(1S)-1-(2-fluorophenyl)propan-1-amine;hydrochloride (CAS 1310923-28-4) is a chemical compound with the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. IUPAC name: (1S)-1-(2-fluorophenyl)propan-1-amine;hydrochloride. InChIKey: VVIJOOJNOZEOGM-FVGYRXGTSA-N.
| Molecular formula | C9H13ClFN |
|---|---|
| Molecular weight | 189.66 g/mol |
| IUPAC name | (1S)-1-(2-fluorophenyl)propan-1-amine;hydrochloride |
| InChIKey | VVIJOOJNOZEOGM-FVGYRXGTSA-N |
| SMILES | CC[C@@H](C1=CC=CC=C1F)N.Cl |
Computed by PubChem (NCBI)