cas: 2769990-88-5 — see every product listed under this CAS number, including other names
(R)-1-(5-Fluoro-2-methoxyphenyl)ethan-1-amine hydrochloride, 97% (CAS 2769990-88-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1939704-5g |
| cas | 2769990-88-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 34345.15 Pln | |
| AmBeed | 10g | 41545.21 Pln | |
| Fluorochem | 100mg | 1700.46 Pln | |
| Fluorochem | 250mg | 2799.03 Pln | |
| Fluorochem | 500mg | 4397.43 Pln | |
| Fluorochem | 1g | 5756.32 Pln | |
| Fluorochem | 5g | 16023.54 Pln | |
| Fluorochem | 10g | 25874.24 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1R)-1-(5-fluoro-2-methoxyphenyl)ethanamine;hydrochloride (CAS 2769990-88-5) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (1R)-1-(5-fluoro-2-methoxyphenyl)ethanamine;hydrochloride. InChIKey: RGEAYGUWTJKOJM-FYZOBXCZSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (1R)-1-(5-fluoro-2-methoxyphenyl)ethanamine;hydrochloride |
| InChIKey | RGEAYGUWTJKOJM-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1)F)OC)N.Cl |
Computed by PubChem (NCBI)