CAS 1391434-75-5 appears in our catalog under these names: (2S)-2-Amino-2-(4-fluoro-2-methylphenyl)ethan-1-ol hydrochloride, 95%, (S)–2–amino–2–(4–fluoro–2–methylphenyl)ethan–1–ol hcl. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(2S)-2-amino-2-(4-fluoro-2-methylphenyl)ethanol;hydrochloride (CAS 1391434-75-5) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (2S)-2-amino-2-(4-fluoro-2-methylphenyl)ethanol;hydrochloride. InChIKey: TWILDFQDSXXDLG-SBSPUUFOSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (2S)-2-amino-2-(4-fluoro-2-methylphenyl)ethanol;hydrochloride |
| InChIKey | TWILDFQDSXXDLG-SBSPUUFOSA-N |
| SMILES | CC1=C(C=CC(=C1)F)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)