CAS 1956437-40-3 appears in our catalog under these names: (2R)-2-Amino-2-(3-fluoro-2-methylphenyl)ethan-1-ol hydrochloride, 95%, (R)–2–Amino–2–(3–fluoro–2–methylphenyl)ethanol hydrochloride, (R)-2-Amino-2-(3-fluoro-2-methylphenyl)ethanol hydrochloride, 95%, 95%, (R)-2-AMINO-2-(3-FLUORO-2-METHYLPHENYL)ETHANOL HCL, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg.
(2R)-2-amino-2-(3-fluoro-2-methylphenyl)ethanol;hydrochloride (CAS 1956437-40-3) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (2R)-2-amino-2-(3-fluoro-2-methylphenyl)ethanol;hydrochloride. InChIKey: ZBQXUHCCNVLRHD-FVGYRXGTSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (2R)-2-amino-2-(3-fluoro-2-methylphenyl)ethanol;hydrochloride |
| InChIKey | ZBQXUHCCNVLRHD-FVGYRXGTSA-N |
| SMILES | CC1=C(C=CC=C1F)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)