CAS 1951425-23-2 appears in our catalog under these names: (S)–2–Amino–2–(3–fluoro–2–methylphenyl)ethanol hydrochloride, (S)-2-Amino-2-(3-fluoro-2-methylphenyl)ethanol hydrochloride, 95%, 95%, (2S)-2-Amino-2-(3-fluoro-2-methylphenyl)ethan-1-ol hydrochloride, 95%. Offered by: GLPBio, Chemat, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-amino-2-(3-fluoro-2-methylphenyl)ethanol;hydrochloride (CAS 1951425-23-2) is a chemical compound with the molecular formula C9H13ClFNO and a molecular weight of 205.66 g/mol. IUPAC name: (2S)-2-amino-2-(3-fluoro-2-methylphenyl)ethanol;hydrochloride. InChIKey: ZBQXUHCCNVLRHD-SBSPUUFOSA-N.
| Molecular formula | C9H13ClFNO |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | (2S)-2-amino-2-(3-fluoro-2-methylphenyl)ethanol;hydrochloride |
| InChIKey | ZBQXUHCCNVLRHD-SBSPUUFOSA-N |
| SMILES | CC1=C(C=CC=C1F)[C@@H](CO)N.Cl |
Computed by PubChem (NCBI)