cas: 3906-16-9 — see every product listed under this CAS number, including other names
(R)-1-(Naphthalen-2-yl)ethanamine, 95% (CAS 3906-16-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229098-250MG |
| cas | 3906-16-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 102.07 Pln | |
| Fluorochem | 1g | 107.27 Pln | |
| Fluorochem | 5g | 185.37 Pln | |
| Fluorochem | 10g | 263.47 Pln | |
| Fluorochem | 25g | 575.86 Pln | |
| Fluorochem | 100g | 2132.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-naphthalen-2-ylethanamine (CAS 3906-16-9) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: (1R)-1-naphthalen-2-ylethanamine. InChIKey: KHSYYLCXQKCYQX-SECBINFHSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | (1R)-1-naphthalen-2-ylethanamine |
| InChIKey | KHSYYLCXQKCYQX-SECBINFHSA-N |
| SMILES | C[C@H](C1=CC2=CC=CC=C2C=C1)N |
Computed by PubChem (NCBI)