CAS 102871-67-0 appears in our catalog under these names: 2,5,7-Trimethylquinoline, 95%, 2,5,7-Trimethylquinoline, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 500mg.
2,5,7-trimethylquinoline (CAS 102871-67-0) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 2,5,7-trimethylquinoline. InChIKey: KUDYKIJCJSRIBX-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 2,5,7-trimethylquinoline |
| InChIKey | KUDYKIJCJSRIBX-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=CC(=C2C=C1)C)C |
Computed by PubChem (NCBI)