CAS 72681-37-9 appears in our catalog under these names: 2,6,7-Trimethylquinoline, 95%, 2,6,7-Trimethylquinoline, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2,6,7-trimethylquinoline (CAS 72681-37-9) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 2,6,7-trimethylquinoline. InChIKey: MMRWJFACJFPXEI-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 2,6,7-trimethylquinoline |
| InChIKey | MMRWJFACJFPXEI-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=C(C(=C2)C)C |
Computed by PubChem (NCBI)