CAS 135-79-5 appears in our catalog under these names: 6-Isopropylquinoline, 98%, 6–Isopropylquinoline, 6-Isopropylquinoline, >98.0%(GC), 6-Isopropylquinoline. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g.
6-propan-2-ylquinoline (CAS 135-79-5) is a chemical compound with the molecular formula C12H13N and a molecular weight of 171.24 g/mol. IUPAC name: 6-propan-2-ylquinoline. InChIKey: NKCQEIXYLHACJC-UHFFFAOYSA-N.
| Molecular formula | C12H13N |
|---|---|
| Molecular weight | 171.24 g/mol |
| IUPAC name | 6-propan-2-ylquinoline |
| InChIKey | NKCQEIXYLHACJC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC2=C(C=C1)N=CC=C2 |
Computed by PubChem (NCBI)