cas: 1012067-91-2 — see every product listed under this CAS number, including other names
(R)-1-(Pyridin-4-yl)ethan-1-amine hydrochloride 98% (CAS 1012067-91-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A801123-100mg |
| cas | 1012067-91-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 615.13 Pln | |
| Ambeed | 1g | 1477.31 Pln | |
| Ambeed | 5g | 4508.88 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A801123 |
(1R)-1-pyridin-4-ylethanamine;dihydrochloride (CAS 1012067-91-2) is a chemical compound with the molecular formula C7H12Cl2N2 and a molecular weight of 195.09 g/mol. IUPAC name: (1R)-1-pyridin-4-ylethanamine;dihydrochloride. InChIKey: JDRXYBFUHCUEFT-QYCVXMPOSA-N.
| Molecular formula | C7H12Cl2N2 |
|---|---|
| Molecular weight | 195.09 g/mol |
| IUPAC name | (1R)-1-pyridin-4-ylethanamine;dihydrochloride |
| InChIKey | JDRXYBFUHCUEFT-QYCVXMPOSA-N |
| SMILES | C[C@H](C1=CC=NC=C1)N.Cl.Cl |
Computed by PubChem (NCBI)