cas: 239105-47-6 — see every product listed under this CAS number, including other names
(R)-1-(p-Tolyl)propan-1-amine hydrochloride, 98% (CAS 239105-47-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209965-100MG |
| cas | 239105-47-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 997.58 Pln | |
| Fluorochem | 1g | 2455.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1R)-1-(4-methylphenyl)propan-1-amine;hydrochloride (CAS 239105-47-6) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1R)-1-(4-methylphenyl)propan-1-amine;hydrochloride. InChIKey: XKTMBXZLOUIZLE-HNCPQSOCSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1R)-1-(4-methylphenyl)propan-1-amine;hydrochloride |
| InChIKey | XKTMBXZLOUIZLE-HNCPQSOCSA-N |
| SMILES | CC[C@H](C1=CC=C(C=C1)C)N.Cl |
Computed by PubChem (NCBI)