CAS 1213479-78-7 appears in our catalog under these names: (S)-1-(2,6-Dimethylphenyl)ethanamine hydrochloride, 95%, (S)–1–(2,6–dimethylphenyl)ethan–1–amine, (S)-1-(2,6-dimethylphenyl)ethan-1-amine 95%, (S)-1-(2,6-Dimethylphenyl)ethanamine hydrochloride, 95% ,, 95% ,. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg, 50mg.
(1S)-1-(2,6-dimethylphenyl)ethanamine;hydrochloride (CAS 1213479-78-7) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1S)-1-(2,6-dimethylphenyl)ethanamine;hydrochloride. InChIKey: JQVDNTMMKLGBLJ-FVGYRXGTSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1S)-1-(2,6-dimethylphenyl)ethanamine;hydrochloride |
| InChIKey | JQVDNTMMKLGBLJ-FVGYRXGTSA-N |
| SMILES | CC1=C(C(=CC=C1)C)[C@H](C)N.Cl |
Computed by PubChem (NCBI)