CAS 856646-02-1 is the registry number for (R)-1-(p-Tolyl)propan-1-amine hydrochloride, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
(1R)-1-(4-methylphenyl)propan-1-amine;hydrochloride (CAS 856646-02-1) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1R)-1-(4-methylphenyl)propan-1-amine;hydrochloride. InChIKey: XKTMBXZLOUIZLE-HNCPQSOCSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1R)-1-(4-methylphenyl)propan-1-amine;hydrochloride |
| InChIKey | XKTMBXZLOUIZLE-HNCPQSOCSA-N |
| SMILES | CC[C@H](C1=CC=C(C=C1)C)N.Cl |
Computed by PubChem (NCBI)