Products 934268-52-7
CAS 934268-52-7 appears in our catalog under these names: (R)-1-Phenylbutylamine hydrochloride, 95%, (R)–1–Phenylbutan–1–amine hydrochloride, (R)-1-Phenylbutan-1-amine hydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g.
(1R)-1-phenylbutan-1-amine;hydrochloride (CAS 934268-52-7) is a chemical compound with the molecular formula C10H16ClN and a molecular weight of 185.69 g/mol. IUPAC name: (1R)-1-phenylbutan-1-amine;hydrochloride. InChIKey: SRLJBKBDJRRHGL-HNCPQSOCSA-N.
| Molecular formula | C10H16ClN |
|---|---|
| Molecular weight | 185.69 g/mol |
| IUPAC name | (1R)-1-phenylbutan-1-amine;hydrochloride |
| InChIKey | SRLJBKBDJRRHGL-HNCPQSOCSA-N |
| SMILES | CCC[C@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)