cas: 536747-87-2 — see every product listed under this CAS number, including other names
(R)-1-(tert-Butoxycarbonyl)-4,4-difluoropyrrolidine-2-carboxylic acid, 97%, 97% (CAS 536747-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0KN-100mg |
| cas | 536747-87-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 290.00 Pln | |
| Chemat | 5g | 851.60 Pln | |
| Chemat | 10g | 1533.20 Pln | |
| Chemat | 25g | 3453.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 536747-87-2) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: WTMZYKCXBXPVPT-ZCFIWIBFSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WTMZYKCXBXPVPT-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H]1C(=O)O)(F)F |
Computed by PubChem (NCBI)