cas: 536747-87-2 — see every product listed under this CAS number, including other names
Boc-D-4,4-DiF-Pro-OH 97% (CAS 536747-87-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A472492-100mg |
| cas | 536747-87-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 214.62 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 526.12 Pln | |
| Ambeed | 5g | 2322.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A472492 |
(2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 536747-87-2) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: WTMZYKCXBXPVPT-ZCFIWIBFSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2R)-4,4-difluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WTMZYKCXBXPVPT-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H]1C(=O)O)(F)F |
Computed by PubChem (NCBI)