cas: 1002359-83-2 — see every product listed under this CAS number, including other names
(R)-1-Boc-piperidine-3-carboxylic acid hydrazide, 97%, 97% (CAS 1002359-83-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112BE-100mg |
| cas | 1002359-83-2 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 424.40 Pln | |
| Chemat | 250mg | 544.40 Pln | |
| Chemat | 500mg | 861.20 Pln | |
| Chemat | 1g | 1264.40 Pln | |
| Chemat | 5g | 4019.60 Pln | |
| Chemat | 10g | 6429.20 Pln | |
| Chemat | 25g | 14066.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 1002359-83-2) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: DABYYYLRDBQJTK-MRVPVSSYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate |
| InChIKey | DABYYYLRDBQJTK-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)NN |
Computed by PubChem (NCBI)