cas: 1002359-83-2 — see every product listed under this CAS number, including other names
(R)-1-Boc-piperidine-3-carboxylic acid hydrazide, 97% (CAS 1002359-83-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g, 25g. Offered by: Combi-blocks, Fluorochem, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-9864-250mg |
| cas | 1002359-83-2 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 638.33 Pln | |
| Fluorochem | 500mg | 1039.24 Pln | |
| Fluorochem | 1g | 1507.82 Pln | |
| Fluorochem | 5g | 4746.26 Pln | |
| Fluorochem | 10g | 7401.58 Pln | |
| Fluorochem | 25g | 18007.22 Pln | |
| Chemat | 100mg | 242.00 Pln | |
| Chemat | 250mg | 299.60 Pln | |
| Chemat | 500mg | 534.80 Pln | |
| Chemat | 1g | 659.60 Pln | |
| Chemat | 5g | 2848.40 Pln | |
| Chemat | 10g | 4518.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 1002359-83-2) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: DABYYYLRDBQJTK-MRVPVSSYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate |
| InChIKey | DABYYYLRDBQJTK-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)NN |
Computed by PubChem (NCBI)