cas: 1002359-83-2 — see every product listed under this CAS number, including other names
(R)-1-Boc-piperidine-3-carboxylic acid hydrazide, 97% (CAS 1002359-83-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg, 5g, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QE-9864-250mg |
| cas | 1002359-83-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 674.78 Pln | |
| Fluorochem | 250mg | 877.83 Pln | |
| Fluorochem | 500mg | 1403.69 Pln | |
| Fluorochem | 1g | 2064.92 Pln | |
| Fluorochem | 5g | 6631.02 Pln | |
| Fluorochem | 10g | 10624.40 Pln | |
| Fluorochem | 25g | 23276.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate (CAS 1002359-83-2) is a chemical compound with the molecular formula C11H21N3O3 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate. InChIKey: DABYYYLRDBQJTK-MRVPVSSYSA-N.
| Molecular formula | C11H21N3O3 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (3R)-3-(hydrazinecarbonyl)piperidine-1-carboxylate |
| InChIKey | DABYYYLRDBQJTK-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](C1)C(=O)NN |
Computed by PubChem (NCBI)