cas: 160706-61-6 — see every product listed under this CAS number, including other names
(R)-1-Cbz-3-(hydroxyMethyl)piperidine, 98%, 98% (CAS 160706-61-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112S5S-100mg |
| cas | 160706-61-6 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 568.40 Pln | |
| Chemat | 10g | 981.20 Pln | |
| Chemat | 500mg | 126.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate (CAS 160706-61-6) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: XLWOOUZKMJBINO-CYBMUJFWSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | XLWOOUZKMJBINO-CYBMUJFWSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)