cas: 160706-61-6 — see every product listed under this CAS number, including other names
(R)-BENZYL 3-(HYDROXYMETHYL)PIPERIDINE-1-CARBOXYLATE, 98% (CAS 160706-61-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F331584-1G |
| cas | 160706-61-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 820.56 Pln | |
| Fluorochem | 10g | 1372.45 Pln | |
| Fluorochem | 25g | 2689.70 Pln | |
| Fluorochem | 100g | 9234.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Benzyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate (CAS 160706-61-6) is a chemical compound with the molecular formula C14H19NO3 and a molecular weight of 249.30 g/mol. IUPAC name: benzyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: XLWOOUZKMJBINO-CYBMUJFWSA-N.
| Molecular formula | C14H19NO3 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | benzyl (3R)-3-(hydroxymethyl)piperidine-1-carboxylate |
| InChIKey | XLWOOUZKMJBINO-CYBMUJFWSA-N |
| SMILES | C1C[C@H](CN(C1)C(=O)OCC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)