cas: 244092-64-6 — see every product listed under this CAS number, including other names
(R)-1-Phenylbut-3-en-2-amine hydrochloride, 95% (CAS 244092-64-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F690618-100MG |
| cas | 244092-64-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1257.91 Pln | |
| Fluorochem | 250mg | 1851.45 Pln | |
| Fluorochem | 1g | 4506.76 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-1-phenylbut-3-en-2-amine;hydrochloride (CAS 244092-64-6) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (2R)-1-phenylbut-3-en-2-amine;hydrochloride. InChIKey: GMQARJHXPFBJRD-PPHPATTJSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (2R)-1-phenylbut-3-en-2-amine;hydrochloride |
| InChIKey | GMQARJHXPFBJRD-PPHPATTJSA-N |
| SMILES | C=C[C@@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)