CAS 141448-55-7 appears in our catalog under these names: (S)-1-Phenylbut-3-en-2-amine hydrochloride, 95%, (S)-1-Phenylbut-3-en-2-amine hydrochloride, 95+%, (S)-1-Phenylbut-3-en-2-amine hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 250mg, 5g.
(2S)-1-phenylbut-3-en-2-amine;hydrochloride (CAS 141448-55-7) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: (2S)-1-phenylbut-3-en-2-amine;hydrochloride. InChIKey: GMQARJHXPFBJRD-HNCPQSOCSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | (2S)-1-phenylbut-3-en-2-amine;hydrochloride |
| InChIKey | GMQARJHXPFBJRD-HNCPQSOCSA-N |
| SMILES | C=C[C@H](CC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)