cas: 256487-77-1 — see every product listed under this CAS number, including other names
(R)-1-tert-Butyl 2-methyl 4-oxopyrrolidine-1,2-dicarboxylate, 98%, 98% (CAS 256487-77-1) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 5kg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C270-1kg |
| cas | 256487-77-1 |
| size | 1kg |
| availability | 10000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 2387.60 Pln | |
| Chemat | 5kg | 11169.60 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 270.80 Pln | |
| Chemat | 50g | 405.20 Pln | |
| Chemat | 100g | 683.60 Pln | |
| Chemat | 250g | 1576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate (CAS 256487-77-1) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: UPBHYYJZVWZCOZ-MRVPVSSYSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | UPBHYYJZVWZCOZ-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)