CAS 915976-41-9 appears in our catalog under these names: 1,2-Piperidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2s)-, 95%, (S)-1-(tert-Butoxycarbonyl)-5-oxopiperidine-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
(2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopiperidine-2-carboxylic acid (CAS 915976-41-9) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopiperidine-2-carboxylic acid. InChIKey: NYIZAJLUNOQXFW-QMMMGPOBSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | (2S)-1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxopiperidine-2-carboxylic acid |
| InChIKey | NYIZAJLUNOQXFW-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)CC[C@H]1C(=O)O |
Computed by PubChem (NCBI)