CAS 102195-80-2 appears in our catalog under these names: (2S)-1-Boc-4-oxo-proline Methyl Ester, Boc–4–oxo–Pro–OMe, Boc-L-Pro(4-keto)-OMe, N-Boc-4-oxo-L-proline methyl ester, 97% , N-BOC-4-oxo-L-proline methyl ester, 97%. Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 2g, 500mg, 25g, 5g, 0,025kg, 0,05kg, 0,1kg.
1-O-tert-butyl 2-O-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate (CAS 102195-80-2) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate. InChIKey: UPBHYYJZVWZCOZ-QMMMGPOBSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | UPBHYYJZVWZCOZ-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)