cas: 128811-48-3 — see every product listed under this CAS number, including other names
(R)-1-tert-Butyl 2-methyl 5-oxopyrrolidine-1,2-dicarboxylate 97% (CAS 128811-48-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164851-1g |
| cas | 128811-48-3 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 159.00 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 453.81 Pln | |
| Ambeed | 500g | 1977.94 Pln | |
| Ambeed | 1000g | 3880.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A164851 |
1-O-tert-butyl 2-O-methyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate (CAS 128811-48-3) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: FNTAOUUEQHKLIU-SSDOTTSWSA-N.
| Molecular formula | C11H17NO5 |
|---|---|
| Molecular weight | 243.26 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate |
| InChIKey | FNTAOUUEQHKLIU-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H](CCC1=O)C(=O)OC |
Computed by PubChem (NCBI)