Products 2270909-30-1

CAS 2270909-30-1 is the registry number for 4-Methoxy-3,3-dimethyl-butyric acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

(2,5-dioxopyrrolidin-1-yl) 4-methoxy-3,3-dimethylbutanoate (CAS 2270909-30-1) is a chemical compound with the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 4-methoxy-3,3-dimethylbutanoate. InChIKey: BVRNPCNHUYEXGA-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17NO5
Molecular weight243.26 g/mol
IUPAC name(2,5-dioxopyrrolidin-1-yl) 4-methoxy-3,3-dimethylbutanoate
InChIKeyBVRNPCNHUYEXGA-UHFFFAOYSA-N
SMILESCC(C)(CC(=O)ON1C(=O)CCC1=O)COC

Computed by PubChem (NCBI)