cas: 401620-74-4 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-cyanophenyl)propanoic acid, 98%, 98% (CAS 401620-74-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYZK-100mg |
| cas | 401620-74-4 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 10g | 2819.60 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1576.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R)-3-(2-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 401620-74-4) is a chemical compound with the molecular formula C25H20N2O4 and a molecular weight of 412.4 g/mol. IUPAC name: (2R)-3-(2-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ACFGBBASKOIPEW-HSZRJFAPSA-N.
| Molecular formula | C25H20N2O4 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (2R)-3-(2-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ACFGBBASKOIPEW-HSZRJFAPSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C#N |
Computed by PubChem (NCBI)