Products 697771-60-1
CAS 697771-60-1 is the registry number for N-(3-Acetamidophenyl)-1-oxo-4-(p-tolyl)-1H-isochromene-3-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-acetamidophenyl)-4-(4-methylphenyl)-1-oxoisochromene-3-carboxamide (CAS 697771-60-1) is a chemical compound with the molecular formula C25H20N2O4 and a molecular weight of 412.4 g/mol. IUPAC name: N-(3-acetamidophenyl)-4-(4-methylphenyl)-1-oxoisochromene-3-carboxamide. InChIKey: LOJSMIYRRHPZQS-UHFFFAOYSA-N.
| Molecular formula | C25H20N2O4 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | N-(3-acetamidophenyl)-4-(4-methylphenyl)-1-oxoisochromene-3-carboxamide |
| InChIKey | LOJSMIYRRHPZQS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=C(OC(=O)C3=CC=CC=C32)C(=O)NC4=CC=CC(=C4)NC(=O)C |
Computed by PubChem (NCBI)