CAS 401620-74-4 appears in our catalog under these names: Fmoc-d-2-cyanophenylalanine, 98%, Fmoc-D-Phe(2-CN)-OH 98%, (R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2-cyanophenyl)propanoic acid, 98%, 98%, FMOC-2-CYANO-D-PHENYLALANINE, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg, 10g.
(2R)-3-(2-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 401620-74-4) is a chemical compound with the molecular formula C25H20N2O4 and a molecular weight of 412.4 g/mol. IUPAC name: (2R)-3-(2-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ACFGBBASKOIPEW-HSZRJFAPSA-N.
| Molecular formula | C25H20N2O4 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (2R)-3-(2-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ACFGBBASKOIPEW-HSZRJFAPSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C#N |
Computed by PubChem (NCBI)