CAS 205526-34-7 appears in our catalog under these names: Fmoc–D–Phe(4–CN)–OH, Fmoc-D-Phe(4-CN)-OH 97%, Fmoc-D-Phe(4-CN)-OH, 97%, 97%, Fmoc-D-Phe(4-CN)-OH, 98.0%, FMOC-4-CYANO-D-PHENYLALANINE, 98%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 500mg, 250mg, 1g, 5g, 25g, 10g, 25 g.
(2R)-3-(4-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 205526-34-7) is a chemical compound with the molecular formula C25H20N2O4 and a molecular weight of 412.4 g/mol. IUPAC name: (2R)-3-(4-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: JOPKKUTWCGYCDA-HSZRJFAPSA-N.
| Molecular formula | C25H20N2O4 |
|---|---|
| Molecular weight | 412.4 g/mol |
| IUPAC name | (2R)-3-(4-cyanophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | JOPKKUTWCGYCDA-HSZRJFAPSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CC4=CC=C(C=C4)C#N)C(=O)O |
Computed by PubChem (NCBI)