cas: 1208226-88-3 — see every product listed under this CAS number, including other names
(R)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oct-7-enoic acid, 97%, 97% (CAS 1208226-88-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119Z0C-100mg |
| cas | 1208226-88-3 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 376.40 Pln | |
| Chemat | 250mg | 712.40 Pln | |
| Chemat | 1g | 1686.80 Pln | |
| Chemat | 5g | 6323.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)oct-7-enoic acid (CAS 1208226-88-3) is a chemical compound with the molecular formula C23H25NO4 and a molecular weight of 379.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)oct-7-enoic acid. InChIKey: UAOCBDJIBBTOBI-OAQYLSRUSA-N.
| Molecular formula | C23H25NO4 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)oct-7-enoic acid |
| InChIKey | UAOCBDJIBBTOBI-OAQYLSRUSA-N |
| SMILES | C=CCCCC[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)