cas: 200937-17-3 — see every product listed under this CAS number, including other names
(R)-2-((tert-Butoxycarbonyl)amino)-4-methylpentanoic acid hydrate, 97%, 97% (CAS 200937-17-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113D4S-5g |
| cas | 200937-17-3 |
| size | 5g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 242.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (CAS 200937-17-3) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 249.30 g/mol. IUPAC name: (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate. InChIKey: URQQEIOTRWJXBA-DDWIOCJRSA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChIKey | URQQEIOTRWJXBA-DDWIOCJRSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)