cas: 200937-17-3 — see every product listed under this CAS number, including other names
BOC-D-LEUCINE MONOHYDRATE, 97% (CAS 200937-17-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F793578-25G |
| cas | 200937-17-3 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 268.67 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (CAS 200937-17-3) is a chemical compound with the molecular formula C11H23NO5 and a molecular weight of 249.30 g/mol. IUPAC name: (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate. InChIKey: URQQEIOTRWJXBA-DDWIOCJRSA-N.
| Molecular formula | C11H23NO5 |
|---|---|
| Molecular weight | 249.30 g/mol |
| IUPAC name | (2R)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| InChIKey | URQQEIOTRWJXBA-DDWIOCJRSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)NC(=O)OC(C)(C)C.O |
Computed by PubChem (NCBI)