cas: 32222-48-3 — see every product listed under this CAS number, including other names
(R)-2-(2-Fluorophenyl)-2-hydroxyacetic acid, 98% (CAS 32222-48-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A448969-1g |
| cas | 32222-48-3 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 486.64 Pln | |
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln | |
| Fluorochem | 1g | 893.45 Pln | |
| Fluorochem | 5g | 3767.44 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R)-2-(2-fluorophenyl)-2-hydroxyacetic acid (CAS 32222-48-3) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: (2R)-2-(2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: WWSRHIZZWWDONI-SSDOTTSWSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | (2R)-2-(2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | WWSRHIZZWWDONI-SSDOTTSWSA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(=O)O)O)F |
Computed by PubChem (NCBI)