CAS 389-31-1 appears in our catalog under these names: 2-Fluoromandelic acid, 98%, 2-Fluoro-DL-mandelic Acid, 97%, 97%, 2-Fluoromandelic acid, 97%, 2-Fluoromandelic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1g, 100mg, 250mg, 10g.
2-(2-fluorophenyl)-2-hydroxyacetic acid (CAS 389-31-1) is a chemical compound with the molecular formula C8H7FO3 and a molecular weight of 170.14 g/mol. IUPAC name: 2-(2-fluorophenyl)-2-hydroxyacetic acid. InChIKey: WWSRHIZZWWDONI-UHFFFAOYSA-N.
| Molecular formula | C8H7FO3 |
|---|---|
| Molecular weight | 170.14 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-2-hydroxyacetic acid |
| InChIKey | WWSRHIZZWWDONI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(=O)O)O)F |
Computed by PubChem (NCBI)