CAS 82732-07-8 appears in our catalog under these names: Carfilzomib Impurity 47, Boc–D–Homophe–OH, Boc-D-HPhe-OH, (R)-2-(Boc-amino)-4-phenylbutyric acid, 98% , BOC-D-HOMOPHE-OH, >=98.0%. Offered by: Chemat Brand, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), Sigma-Aldrich. Available pack sizes: on request, 1g, 5g, 25g, 100g, 10g, 50g, 500g.
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid (CAS 82732-07-8) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid. InChIKey: MCODLPJUFHPVQP-GFCCVEGCSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid |
| InChIKey | MCODLPJUFHPVQP-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)