CAS 499995-74-3 appears in our catalog under these names: (S)–3–((tert–Butoxycarbonyl)amino)–3–(o–tolyl)propanoic acid, Boc-2-methyl-d-beta-phenylalanine, 95%, (S)-BOC-2-METHYL-BETA-PHE-OH, >=98.0%. Offered by: GLPBio, Combi-blocks, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 250mg, 5g, 500MG.
(3S)-3-(2-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 499995-74-3) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (3S)-3-(2-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: WWDMSBGBNGEQDH-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (3S)-3-(2-methylphenyl)-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | WWDMSBGBNGEQDH-LBPRGKRZSA-N |
| SMILES | CC1=CC=CC=C1[C@H](CC(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)