CAS 65635-85-0 appears in our catalog under these names: (R)-2-(((Benzyloxy)carbonyl)(methyl)amino)-4-methylpentanoic acid, 95%, (R)–2–(((Benzyloxy)carbonyl)(methyl)amino)–4–methylpentanoic acid, Cbz-D-N-Me-Leu-OH 98%, N-Methyl-N-[(phenylmethoxy)carbonyl]-D-leucine, 98%, 98%, (R)-2-(((Benzyloxy)carbonyl)(methyl)amino)-4-methylpentanoic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg.
(2R)-4-methyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanoic acid (CAS 65635-85-0) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2R)-4-methyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanoic acid. InChIKey: TVXSGOBGRXNJLM-CYBMUJFWSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2R)-4-methyl-2-[methyl(phenylmethoxycarbonyl)amino]pentanoic acid |
| InChIKey | TVXSGOBGRXNJLM-CYBMUJFWSA-N |
| SMILES | CC(C)C[C@H](C(=O)O)N(C)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)