CAS 189619-55-4 appears in our catalog under these names: (S)-2-Benzyl-3-(tert-butoxycarbonylamino)propanoic acid, 95%, (S)-Boc-β2-HoPhe-OH 95%, (S)-2-Benzyl-3-((tert-butoxycarbonyl)amino)propanoic acid, 95%, 95%, (S)-2-Benzyl-3-((tert-butoxycarbonyl)amino)propanoic acid, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
(2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 189619-55-4) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: ZYCITKXROAFBAR-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (2S)-2-benzyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | ZYCITKXROAFBAR-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)