(R)-2-(Trifluoromethyl)morpholine hydrochloride, 98%
cas: 1394909-70-6 — see every product listed under this CAS number, including other names
(R)-2-(Trifluoromethyl)morpholine hydrochloride, 98% (CAS 1394909-70-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F620600-100MG |
| cas | 1394909-70-6 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 560.24 Pln | |
| Fluorochem | 250mg | 1185.02 Pln | |
| Fluorochem | 500mg | 1960.79 Pln | |
| Fluorochem | 1g | 3215.55 Pln | |
| Fluorochem | 5g | 11827.10 Pln | |
| Fluorochem | 10g | 20225.19 Pln | |
| Ambeed | 100mg | 559.50 Pln | |
| Ambeed | 250mg | 1154.69 Pln | |
| Ambeed | 1g | 2979.19 Pln | |
| Ambeed | 5g | 11272.88 Pln | |
| Ambeed | 10g | 17997.94 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(2R)-2-(trifluoromethyl)morpholine;hydrochloride (CAS 1394909-70-6) is a chemical compound with the molecular formula C5H9ClF3NO and a molecular weight of 191.58 g/mol. IUPAC name: (2R)-2-(trifluoromethyl)morpholine;hydrochloride. InChIKey: INIKTCFEWCCJMM-PGMHMLKASA-N.
| Molecular formula | C5H9ClF3NO |
|---|---|
| Molecular weight | 191.58 g/mol |
| IUPAC name | (2R)-2-(trifluoromethyl)morpholine;hydrochloride |
| InChIKey | INIKTCFEWCCJMM-PGMHMLKASA-N |
| SMILES | C1CO[C@H](CN1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)