CAS 1430086-53-5 appears in our catalog under these names: (3R)-3-(trifluoromethyl)morpholine hydrochloride, 95%, (3R)-3-(Trifluoromethyl)morpholine hydrochloride, (R)-3-(Trifluoromethyl)morpholine hydrochloride 97%, (R)-3-(Trifluoromethyl)morpholine hydrochloride, 97%, 97%, (R)-3-(Trifluoromethyl)morpholine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 50mg, 5g.
(3R)-3-(trifluoromethyl)morpholine;hydrochloride (CAS 1430086-53-5) is a chemical compound with the molecular formula C5H9ClF3NO and a molecular weight of 191.58 g/mol. IUPAC name: (3R)-3-(trifluoromethyl)morpholine;hydrochloride. InChIKey: OHFRHIUJBMHGLQ-PGMHMLKASA-N.
| Molecular formula | C5H9ClF3NO |
|---|---|
| Molecular weight | 191.58 g/mol |
| IUPAC name | (3R)-3-(trifluoromethyl)morpholine;hydrochloride |
| InChIKey | OHFRHIUJBMHGLQ-PGMHMLKASA-N |
| SMILES | C1COC[C@@H](N1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)