CAS 1394909-70-6 appears in our catalog under these names: (2R)-2-(Trifluoromethyl)morpholine hydrochloride, 97%, (2R)-2-(Trifluoromethyl)morpholine hydrochloride, (2R)-2-(trifluoromethyl)morpholine hydrochloride, 97%, 97%, (R)-2-(Trifluoromethyl)morpholine hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 50mg, 0,5g, 500mg.
(2R)-2-(trifluoromethyl)morpholine;hydrochloride (CAS 1394909-70-6) is a chemical compound with the molecular formula C5H9ClF3NO and a molecular weight of 191.58 g/mol. IUPAC name: (2R)-2-(trifluoromethyl)morpholine;hydrochloride. InChIKey: INIKTCFEWCCJMM-PGMHMLKASA-N.
| Molecular formula | C5H9ClF3NO |
|---|---|
| Molecular weight | 191.58 g/mol |
| IUPAC name | (2R)-2-(trifluoromethyl)morpholine;hydrochloride |
| InChIKey | INIKTCFEWCCJMM-PGMHMLKASA-N |
| SMILES | C1CO[C@H](CN1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)