Products 1394909-69-3
CAS 1394909-69-3 appears in our catalog under these names: (2S)-2-(Trifluoromethyl)morpholine hydrochloride, 97%, (S)-2-(Trifluoromethyl)morpholine hydrochloride, 97%, (2S)-2-(Trifluoromethyl)morpholine hydrochloride, (S)-2-(Trifluoromethyl)morpholine hydrochloride 95%, (2S)-2-(trifluoromethyl)morpholine hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 10g, 5g, 1g, 250mg, 50mg, 0,5g.
(2S)-2-(trifluoromethyl)morpholine;hydrochloride (CAS 1394909-69-3) is a chemical compound with the molecular formula C5H9ClF3NO and a molecular weight of 191.58 g/mol. IUPAC name: (2S)-2-(trifluoromethyl)morpholine;hydrochloride. InChIKey: INIKTCFEWCCJMM-WCCKRBBISA-N.
| Molecular formula | C5H9ClF3NO |
|---|---|
| Molecular weight | 191.58 g/mol |
| IUPAC name | (2S)-2-(trifluoromethyl)morpholine;hydrochloride |
| InChIKey | INIKTCFEWCCJMM-WCCKRBBISA-N |
| SMILES | C1CO[C@@H](CN1)C(F)(F)F.Cl |
Computed by PubChem (NCBI)