cas: 78603-93-7 — see every product listed under this CAS number, including other names
(R)-2-Amino-1,1-diphenylpropan-1-ol, 97%, 97% (CAS 78603-93-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114C9O-100mg |
| cas | 78603-93-7 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 462.80 Pln | |
| Chemat | 10g | 866.00 Pln | |
| Chemat | 25g | 1864.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2R)-2-amino-1,1-diphenylpropan-1-ol (CAS 78603-93-7) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (2R)-2-amino-1,1-diphenylpropan-1-ol. InChIKey: FMBMNSFOFOAIMZ-GFCCVEGCSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (2R)-2-amino-1,1-diphenylpropan-1-ol |
| InChIKey | FMBMNSFOFOAIMZ-GFCCVEGCSA-N |
| SMILES | C[C@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)