cas: 78603-93-7 — see every product listed under this CAS number, including other names
(R)-2-Amino-1,1-diphenylpropan-1-ol, 97% (CAS 78603-93-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F496785-5G |
| cas | 78603-93-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 341.56 Pln | |
| Fluorochem | 10g | 607.10 Pln | |
| Fluorochem | 25g | 1356.83 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R)-2-amino-1,1-diphenylpropan-1-ol (CAS 78603-93-7) is a chemical compound with the molecular formula C15H17NO and a molecular weight of 227.30 g/mol. IUPAC name: (2R)-2-amino-1,1-diphenylpropan-1-ol. InChIKey: FMBMNSFOFOAIMZ-GFCCVEGCSA-N.
| Molecular formula | C15H17NO |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | (2R)-2-amino-1,1-diphenylpropan-1-ol |
| InChIKey | FMBMNSFOFOAIMZ-GFCCVEGCSA-N |
| SMILES | C[C@H](C(C1=CC=CC=C1)(C2=CC=CC=C2)O)N |
Computed by PubChem (NCBI)